Acarviosin is a sugar composed of cyclohexitol linked to a 4-amino-4,6-dideoxy-D-glucopyranose. Acarviosin is part of the potent α-amylase inhibitor acarbose and its derivatives. The nitrogen atom binds to α-amylase more tightly than the natural substrate making it more potent than other inhibitors. Several other acarviosin-containing α-amylase inhibitors have been found in microbes including isovalertatins [1] and butytatins [2] from Streptomyces luteogriseus and longer oligosaccharides from Streptomyces coelicoflavus.[3]
Acarviosin |
| Names |
|---|
| IUPAC name Methyl 4,6-dideoxy-4-{[(1R,4S,5R,6R)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino}-α-D-glucopyranoside |
| Identifiers |
|---|
CAS Number | - 80943-41-5

|
3D model (JSmol) | |
| ChemSpider | - 2340579

|
| |
| - DTXSID30161850

|
InChI=1S/C14H25NO8/c1-5-8(11(19)13(21)14(22-2)23-5)15-7-3-6(4-16)9(17)12(20)10(7)18/h3,5,7-21H,4H2,1-2H3/t5-,7-,8-,9+,10-,11+,12-,13-,14+/m1/s1  Key: KFHKERRGDZTZQJ-HHHVGSORSA-N  InChI=1/C14H25NO8/c1-5-8(11(19)13(21)14(22-2)23-5)15-7-3-6(4-16)9(17)12(20)10(7)18/h3,5,7-21H,4H2,1-2H3/t5-,7-,8-,9+,10-,11+,12-,13-,14+/m1/s1 Key: KFHKERRGDZTZQJ-HHHVGSORBI
|
O[C@@H]2[C@@H](O)[C@H](N[C@@H]1/C=C(/CO)[C@H](O)[C@@H](O)[C@@H]1O)[C@H](O[C@@H]2OC)C
|
| Properties |
|---|
Chemical formula | C14H25NO8 |
| Molar mass | 335.353 g·mol−1 |
| Density | 1.488 g/mL |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
verify (what is  ?) |
| Infobox references |
| |