Glisoxepide (INN) is an orally available anti-diabetic drug from the group of sulfonylureas.[1] It belongs to second-generation sulfonylureas.[2]
Glisoxepide |
 |
| Names |
|---|
| IUPAC name N-[2-[4-(azepan-1-ylcarbamoylsulfamoyl)phenyl]ethyl]-5-methyl-1,2-oxazole-3-carboxamide |
| Identifiers |
|---|
CAS Number | - 25046-79-1

|
3D model (JSmol) | |
| ChEMBL | - ChEMBL2106618

|
| ChemSpider | - 30380

|
| DrugBank | - DB01289

|
| ECHA InfoCard | 100.042.329  |
| KEGG | - D07118

|
| |
| UNII | - H7SC0I332I

|
| - DTXSID9023097

|
InChI=1S/C20H27N5O5S/c1-15-14-18(23-30-15)19(26)21-11-10-16-6-8-17(9-7-16)31(28,29)24-20(27)22-25-12-4-2-3-5-13-25/h6-9,14H,2-5,10-13H2,1H3,(H,21,26)(H2,22,24,27)  Key: ZKUDBRCEOBOWLF-UHFFFAOYSA-N  InChI=1/C20H27N5O5S/c1-15-14-18(23-30-15)19(26)21-11-10-16-6-8-17(9-7-16)31(28,29)24-20(27)22-25-12-4-2-3-5-13-25/h6-9,14H,2-5,10-13H2,1H3,(H,21,26)(H2,22,24,27) Key: ZKUDBRCEOBOWLF-UHFFFAOYAG
|
O=C(NCCc1ccc(cc1)S(=O)(=O)NC(=O)NN2CCCCCC2)c3noc(c3)C
|
| Properties |
|---|
Chemical formula | C20H27N5O5S |
| Molar mass | 449.52388 g/mol |
| Pharmacology |
|---|
ATC code | A10BB11 (WHO) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
verify (what is  ?) |
| Infobox references |
| |