Metahexamide (INN) is an anti-diabetic drug from the group of sulfonylureas. It is long-acting and belongs to the first-generation cyclohexyl-containing sulfonylureas. It was first described in 1959.[1]
Metahexamide |
| Names |
|---|
| IUPAC name 1-(3-amino-4-methylphenyl)sulfonyl-3-cyclohexylurea |
| Identifiers |
|---|
CAS Number | - 565-33-3

|
3D model (JSmol) | |
| ChEMBL | - ChEMBL507419

|
| ChemSpider | - 10785

|
| ECHA InfoCard | 100.008.434  |
| KEGG | - D07117

|
| |
| UNII | - T3U6F5D722

|
| - DTXSID3023267

|
InChI=1S/C14H21N3O3S/c1-10-7-8-12(9-13(10)15)21(19,20)17-14(18)16-11-5-3-2-4-6-11/h7-9,11H,2-6,15H2,1H3,(H2,16,17,18)  Key: XXYTXQGCRQLRHA-UHFFFAOYSA-N  InChI=1/C14H21N3O3S/c1-10-7-8-12(9-13(10)15)21(19,20)17-14(18)16-11-5-3-2-4-6-11/h7-9,11H,2-6,15H2,1H3,(H2,16,17,18) Key: XXYTXQGCRQLRHA-UHFFFAOYAB
|
CC1=C(C=C(C=C1)S(=O)(=O)NC(=O)NC2CCCCC2)N
|
| Properties |
|---|
Chemical formula | C14H21N3O3S |
| Molar mass | 311.4 g/mol |
| Pharmacology |
|---|
ATC code | A10BB10 (WHO) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
verify (what is  ?) |
| Infobox references |
| |